CAS 1618107-78-0 is the registry number for 2-Methyl-1-tosyl-1H-indol-5-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-methyl-1-(4-methylphenyl)sulfonylindol-5-amine (CAS 1618107-78-0) is a chemical compound with the molecular formula C16H16N2O2S and a molecular weight of 300.4 g/mol. IUPAC name: 2-methyl-1-(4-methylphenyl)sulfonylindol-5-amine. InChIKey: SRSAGSGLEYFGQG-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2S |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 2-methyl-1-(4-methylphenyl)sulfonylindol-5-amine |
| InChIKey | SRSAGSGLEYFGQG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2C=CC(=C3)N)C |
Computed by PubChem (NCBI)