CAS 73424-46-1 appears in our catalog under these names: 4-Methyl- (2,3-dihydro-1H-inden-1-ylidene)-benzenesulfonic acid hydrazide, (E)-N'-(2,3-Dihydro-1H-inden-1-ylidene)-4-methylbenzenesulfonohydrazide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
N-[(E)-2,3-dihydroinden-1-ylideneamino]-4-methylbenzenesulfonamide (CAS 73424-46-1) is a chemical compound with the molecular formula C16H16N2O2S and a molecular weight of 300.4 g/mol. IUPAC name: N-[(E)-2,3-dihydroinden-1-ylideneamino]-4-methylbenzenesulfonamide. InChIKey: YOWVLOMBIBKGFG-WUKNDPDISA-N.
| Molecular formula | C16H16N2O2S |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | YOWVLOMBIBKGFG-WUKNDPDISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/2\CCC3=CC=CC=C32 |
Computed by PubChem (NCBI)