CAS 16182-17-5 is the registry number for N'-Cyclohexylidene-2,4,6-trimethylbenzenesulfonohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(cyclohexylideneamino)-2,4,6-trimethylbenzenesulfonamide (CAS 16182-17-5) is a chemical compound with the molecular formula C15H22N2O2S and a molecular weight of 294.4 g/mol. IUPAC name: N-(cyclohexylideneamino)-2,4,6-trimethylbenzenesulfonamide. InChIKey: ROHCZDIDKRQCNJ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2S |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-(cyclohexylideneamino)-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | ROHCZDIDKRQCNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NN=C2CCCCC2)C |
Computed by PubChem (NCBI)