Products 333985-88-9

CAS 333985-88-9 is the registry number for 4-(Pyridin-2-ylsulfanyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-pyridin-2-ylsulfanylpiperidine-1-carboxylate (CAS 333985-88-9) is a chemical compound with the molecular formula C15H22N2O2S and a molecular weight of 294.4 g/mol. IUPAC name: tert-butyl 4-pyridin-2-ylsulfanylpiperidine-1-carboxylate. InChIKey: ZEFLQMDMWUADPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O2S
Molecular weight294.4 g/mol
IUPAC nametert-butyl 4-pyridin-2-ylsulfanylpiperidine-1-carboxylate
InChIKeyZEFLQMDMWUADPQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)SC2=CC=CC=N2

Computed by PubChem (NCBI)