Products 1619-29-0
CAS 1619-29-0 is the registry number for Helminthosporol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,4R,5S,8S)-8-(hydroxymethyl)-1,7-dimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-ene-6-carbaldehyde (CAS 1619-29-0) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (1R,4R,5S,8S)-8-(hydroxymethyl)-1,7-dimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-ene-6-carbaldehyde. InChIKey: JNDNSKMAFGPBFU-BEAPCOKYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (1R,4R,5S,8S)-8-(hydroxymethyl)-1,7-dimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-ene-6-carbaldehyde |
| InChIKey | JNDNSKMAFGPBFU-BEAPCOKYSA-N |
| SMILES | CC1=C([C@H]2[C@H](CC[C@@]1([C@H]2CO)C)C(C)C)C=O |
Computed by PubChem (NCBI)