Products 161957-55-7
CAS 161957-55-7 appears in our catalog under these names: 3–Chloro–2–fluorobenzoic Acid, 3-Chloro-2-fluorobenzoic Acid, >97.0%(GC)(T), 3-Chloro-2-fluorobenzoic acid 98%, 3-Chloro-2-fluorobenzoic acid, 98%, 98%, 3-Chloro-2-fluorobenzoic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1000g, 1g, 10g, 500g, 1kg.
3-chloro-2-fluorobenzoic acid (CAS 161957-55-7) is a chemical compound with the molecular formula C7H4ClFO2 and a molecular weight of 174.55 g/mol. IUPAC name: 3-chloro-2-fluorobenzoic acid. InChIKey: FCSSYEWURMTUSM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO2 |
|---|---|
| Molecular weight | 174.55 g/mol |
| IUPAC name | 3-chloro-2-fluorobenzoic acid |
| InChIKey | FCSSYEWURMTUSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C(=O)O |
Computed by PubChem (NCBI)