CAS 1619903-75-1 is the registry number for 3-Bromo-1,1-difluoro-6-nitro-2,3-dihydro-1H-indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3,3-difluoro-5-nitro-1,2-dihydroindene (CAS 1619903-75-1) is a chemical compound with the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. IUPAC name: 1-bromo-3,3-difluoro-5-nitro-1,2-dihydroindene. InChIKey: PGVXGAQPBFYHQY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO2 |
|---|---|
| Molecular weight | 278.05 g/mol |
| IUPAC name | 1-bromo-3,3-difluoro-5-nitro-1,2-dihydroindene |
| InChIKey | PGVXGAQPBFYHQY-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C1(F)F)C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)