Products 2845281-43-6
CAS 2845281-43-6 is the registry number for 8-Bromo-2,2-difluoro-3,4-dihydrobenzo[f][1,4]oxazepin-5(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2,2-difluoro-3,4-dihydro-1,4-benzoxazepin-5-one (CAS 2845281-43-6) is a chemical compound with the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. IUPAC name: 8-bromo-2,2-difluoro-3,4-dihydro-1,4-benzoxazepin-5-one. InChIKey: QQHSEGQYCCJAOS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO2 |
|---|---|
| Molecular weight | 278.05 g/mol |
| IUPAC name | 8-bromo-2,2-difluoro-3,4-dihydro-1,4-benzoxazepin-5-one |
| InChIKey | QQHSEGQYCCJAOS-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C=CC(=C2)Br)C(=O)N1)(F)F |
Computed by PubChem (NCBI)