CAS 1619982-49-8 is the registry number for 2,6-dibromo-4-(2,4-dibromophenoxy)-Phenol. Offered by: TRC. Available pack sizes: 50mg.
2,6-dibromo-4-(2,4-dibromophenoxy)phenol (CAS 1619982-49-8) is a chemical compound with the molecular formula C12H6Br4O2 and a molecular weight of 501.79 g/mol. IUPAC name: 2,6-dibromo-4-(2,4-dibromophenoxy)phenol. InChIKey: XPEXQXQNICTMKI-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O2 |
|---|---|
| Molecular weight | 501.79 g/mol |
| IUPAC name | 2,6-dibromo-4-(2,4-dibromophenoxy)phenol |
| InChIKey | XPEXQXQNICTMKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)OC2=CC(=C(C(=C2)Br)O)Br |
Computed by PubChem (NCBI)