CAS 1622183-96-3 is the registry number for 4'-OH-2,3',5',6-Tetrabromodiphenyl Ether. Offered by: TRC. Available pack sizes: 250mg.
2,6-dibromo-4-(2,6-dibromophenoxy)phenol (CAS 1622183-96-3) is a chemical compound with the molecular formula C12H6Br4O2 and a molecular weight of 501.79 g/mol. IUPAC name: 2,6-dibromo-4-(2,6-dibromophenoxy)phenol. InChIKey: APAMXFBEBPWCIO-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O2 |
|---|---|
| Molecular weight | 501.79 g/mol |
| IUPAC name | 2,6-dibromo-4-(2,6-dibromophenoxy)phenol |
| InChIKey | APAMXFBEBPWCIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC2=CC(=C(C(=C2)Br)O)Br)Br |
Computed by PubChem (NCBI)