CAS 1619986-65-0 appears in our catalog under these names: D6-Orange II sodium salt, D6-Orange II sodium salt, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x10mg, 1x1ml.
Sodium 4-[(2Z)-2-(3,4,5,6,7,8-hexadeuterio-2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate (CAS 1619986-65-0) is a chemical compound with the molecular formula C16H11N2NaO4S and a molecular weight of 356.4 g/mol. IUPAC name: sodium 4-[(2Z)-2-(3,4,5,6,7,8-hexadeuterio-2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate. InChIKey: IGQFKZCLTLAWLO-HGINAYDPSA-M.
| Molecular formula | C16H11N2NaO4S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | sodium 4-[(2Z)-2-(3,4,5,6,7,8-hexadeuterio-2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate |
| InChIKey | IGQFKZCLTLAWLO-HGINAYDPSA-M |
| SMILES | [2H]C1=C(C(=C\2C(=C1[2H])C(=C(C(=O)/C2=N\NC3=CC=C(C=C3)S(=O)(=O)[O-])[2H])[2H])[2H])[2H].[Na+] |
Computed by PubChem (NCBI)