CAS 1934-20-9 appears in our catalog under these names: Crocein Orange G, Crocein Orange G, Crocein orange G BS, Acidorange12dye, Crocein orange G (C.I. 15970), for microscopy, 5 g, glass. Offered by: TRC, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 25g, 5g, 250g, 500g.
Sodium 6-hydroxy-5-phenyldiazenylnaphthalene-2-sulfonate (CAS 1934-20-9) is a chemical compound with the molecular formula C16H11N2NaO4S and a molecular weight of 350.3 g/mol. IUPAC name: sodium 6-hydroxy-5-phenyldiazenylnaphthalene-2-sulfonate. InChIKey: YOCIQNIEQYCORH-UHFFFAOYSA-M.
| Molecular formula | C16H11N2NaO4S |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | sodium 6-hydroxy-5-phenyldiazenylnaphthalene-2-sulfonate |
| InChIKey | YOCIQNIEQYCORH-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)