CAS 1620749-79-2 is the registry number for 3-Bromo-2-(trifluoromethyl)quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3-bromo-2-(trifluoromethyl)quinoline (CAS 1620749-79-2) is a chemical compound with the molecular formula C10H5BrF3N and a molecular weight of 276.05 g/mol. IUPAC name: 3-bromo-2-(trifluoromethyl)quinoline. InChIKey: PFQYVTJWJFUYCH-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3N |
|---|---|
| Molecular weight | 276.05 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethyl)quinoline |
| InChIKey | PFQYVTJWJFUYCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)C(F)(F)F)Br |
Computed by PubChem (NCBI)