CAS 1782509-09-4 appears in our catalog under these names: 4-bromo-6-(trifluoromethyl)isoquinoline, 4-Bromo-6-(trifluoromethyl)isoquinoline, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
4-bromo-6-(trifluoromethyl)isoquinoline (CAS 1782509-09-4) is a chemical compound with the molecular formula C10H5BrF3N and a molecular weight of 276.05 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)isoquinoline. InChIKey: BHLMEFHULAMRLC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3N |
|---|---|
| Molecular weight | 276.05 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethyl)isoquinoline |
| InChIKey | BHLMEFHULAMRLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)