CAS 16208-17-6 appears in our catalog under these names: 4-Methoxyphenylglyoxal hydrate, 95%, 4-Methoxyphenylglyoxal hydrate, 95%, dry wt. basis . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(4-methoxyphenyl)-2-oxoacetaldehyde;hydrate (CAS 16208-17-6) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2-(4-methoxyphenyl)-2-oxoacetaldehyde;hydrate. InChIKey: VPGRGFXPHBTWAZ-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | VPGRGFXPHBTWAZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)