CAS 16209-00-0 appears in our catalog under these names: 4–(1H–Pyrazol–1–yl)benzoic acid, 4-(1H-Pyrazol-1-yl)benzoic Acid, >98.0%(GC), 4-(1H-Pyrazol-1-yl)benzoic Acid, 98%, 98%, 4-(1H-Pyrazol-1-yl)benzoic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-pyrazol-1-ylbenzoic acid (CAS 16209-00-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 4-pyrazol-1-ylbenzoic acid. InChIKey: XOEKYPIBVOGCDG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-pyrazol-1-ylbenzoic acid |
| InChIKey | XOEKYPIBVOGCDG-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)