Products 1620955-76-1

CAS 1620955-76-1 is the registry number for tert-Butyl pyrrolidine-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl pyrrolidine-3-carboxylate;hydrochloride (CAS 1620955-76-1) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl pyrrolidine-3-carboxylate;hydrochloride. InChIKey: VWUUCHCTXOIYMN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC nametert-butyl pyrrolidine-3-carboxylate;hydrochloride
InChIKeyVWUUCHCTXOIYMN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CCNC1.Cl

Computed by PubChem (NCBI)