Products 1621171-19-4
CAS 1621171-19-4 appears in our catalog under these names: Pregabalin Impurity 18, Pregabalin Impurity 87, (3S)-3-(Cyanomethyl)-5-methylhexanoic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3S)-3-(cyanomethyl)-5-methylhexanoic acid (CAS 1621171-19-4) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (3S)-3-(cyanomethyl)-5-methylhexanoic acid. InChIKey: CCVSLUOUOXLAKA-MRVPVSSYSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (3S)-3-(cyanomethyl)-5-methylhexanoic acid |
| InChIKey | CCVSLUOUOXLAKA-MRVPVSSYSA-N |
| SMILES | CC(C)C[C@@H](CC#N)CC(=O)O |
Computed by PubChem (NCBI)