Products 1621383-26-3
CAS 1621383-26-3 is the registry number for O1-tert-butyl O2-ethyl (2S,4R)-4-methylpiperidine-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-O-tert-butyl 2-O-ethyl (2S,4R)-4-methylpiperidine-1,2-dicarboxylate (CAS 1621383-26-3) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-methylpiperidine-1,2-dicarboxylate. InChIKey: VNJJRIGMJMVEKO-MNOVXSKESA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-methylpiperidine-1,2-dicarboxylate |
| InChIKey | VNJJRIGMJMVEKO-MNOVXSKESA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](CCN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)