CAS 1621961-57-6 appears in our catalog under these names: (S)-5-Oxopiperazine-2-carboxylic acid hydrochloride, 95%, (S)-5-Oxopiperazine-2-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-5-oxopiperazine-2-carboxylic acid;hydrochloride (CAS 1621961-57-6) is a chemical compound with the molecular formula C5H9ClN2O3 and a molecular weight of 180.59 g/mol. IUPAC name: (2S)-5-oxopiperazine-2-carboxylic acid;hydrochloride. InChIKey: XDOSJCFGYLXAHC-DFWYDOINSA-N.
| Molecular formula | C5H9ClN2O3 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | (2S)-5-oxopiperazine-2-carboxylic acid;hydrochloride |
| InChIKey | XDOSJCFGYLXAHC-DFWYDOINSA-N |
| SMILES | C1[C@H](NCC(=O)N1)C(=O)O.Cl |
Computed by PubChem (NCBI)