Products 1922857-21-3

CAS 1922857-21-3 appears in our catalog under these names: 5–Oxopiperazine–2–carboxylic acid hydrochloride, 5-Oxopiperazine-2-carboxylic acid hydrochloride 95%, 5-Oxopiperazine-2-carboxylic acid hydrochloride, 95%, 95%, 5-Oxopiperazine-2-carboxylic acid hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-oxopiperazine-2-carboxylic acid;hydrochloride (CAS 1922857-21-3) is a chemical compound with the molecular formula C5H9ClN2O3 and a molecular weight of 180.59 g/mol. IUPAC name: 5-oxopiperazine-2-carboxylic acid;hydrochloride. InChIKey: XDOSJCFGYLXAHC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN2O3
Molecular weight180.59 g/mol
IUPAC name5-oxopiperazine-2-carboxylic acid;hydrochloride
InChIKeyXDOSJCFGYLXAHC-UHFFFAOYSA-N
SMILESC1C(NCC(=O)N1)C(=O)O.Cl

Computed by PubChem (NCBI)