CAS 1622159-27-6 is the registry number for 3,5-Dimethylbenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethyl-1,2-benzothiazole 1,1-dioxide (CAS 1622159-27-6) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 3,5-dimethyl-1,2-benzothiazole 1,1-dioxide. InChIKey: WTAZSEZKZLKWFM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 3,5-dimethyl-1,2-benzothiazole 1,1-dioxide |
| InChIKey | WTAZSEZKZLKWFM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)S(=O)(=O)N=C2C |
Computed by PubChem (NCBI)