Products 1622159-27-6

CAS 1622159-27-6 is the registry number for 3,5-Dimethylbenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,5-dimethyl-1,2-benzothiazole 1,1-dioxide (CAS 1622159-27-6) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 3,5-dimethyl-1,2-benzothiazole 1,1-dioxide. InChIKey: WTAZSEZKZLKWFM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO2S
Molecular weight195.24 g/mol
IUPAC name3,5-dimethyl-1,2-benzothiazole 1,1-dioxide
InChIKeyWTAZSEZKZLKWFM-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)S(=O)(=O)N=C2C

Computed by PubChem (NCBI)