CAS 1622227-53-5 is the registry number for 2-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1622227-53-5) is a chemical compound with the molecular formula C12H20BNO2S and a molecular weight of 253.17 g/mol. IUPAC name: 2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: APMIKKRUGPNYON-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO2S |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | APMIKKRUGPNYON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)C(C)C |
Computed by PubChem (NCBI)