CAS 2223054-42-8 is the registry number for 4–(iso–Propyl)thiazole–5–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 2223054-42-8) is a chemical compound with the molecular formula C12H20BNO2S and a molecular weight of 253.17 g/mol. IUPAC name: 4-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: VAWGERWNWVLQQR-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO2S |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 4-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | VAWGERWNWVLQQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CS2)C(C)C |
Computed by PubChem (NCBI)