Products 162240-95-1
CAS 162240-95-1 appears in our catalog under these names: (3S,5S)-1-Benzyl-3,5-dimethylpiperazine, 98%, (3S,5S)-1-Benzyl-3,5-dimethylpiperazine, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3S,5S)-1-benzyl-3,5-dimethylpiperazine (CAS 162240-95-1) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: (3S,5S)-1-benzyl-3,5-dimethylpiperazine. InChIKey: HTDQGGNOPNSEKT-RYUDHWBXSA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (3S,5S)-1-benzyl-3,5-dimethylpiperazine |
| InChIKey | HTDQGGNOPNSEKT-RYUDHWBXSA-N |
| SMILES | C[C@H]1CN(C[C@@H](N1)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)