Products 1622426-24-7
CAS 1622426-24-7 is the registry number for Serine Hydrolase Inhibitor-19. Offered by: Sigma-Aldrich. Available pack sizes: 5MG.
Tert-butyl N-methyl-N-[2-[methyl-(4-methylpyrazole-1-carbonyl)amino]ethyl]carbamate (CAS 1622426-24-7) is a chemical compound with the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. IUPAC name: tert-butyl N-methyl-N-[2-[methyl-(4-methylpyrazole-1-carbonyl)amino]ethyl]carbamate. InChIKey: OGWFKBLFWLXJQC-UHFFFAOYSA-N.
| Molecular formula | C14H24N4O3 |
|---|---|
| Molecular weight | 296.37 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[2-[methyl-(4-methylpyrazole-1-carbonyl)amino]ethyl]carbamate |
| InChIKey | OGWFKBLFWLXJQC-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)C(=O)N(C)CCN(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)