CAS 16225-26-6 appears in our catalog under these names: 3,5–Di–tert–butylbenzoic acid, 3,5-Di-tert-butylbenzoic acid, 99% , 3,5-Di-(tert-butyl)benzoic acid, 3,5-Di-tert-butylbenzoic Acid, >98.0%(GC)(T), 3,5-Di-tert-butylbenzoic acid, 99%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 25g, 5g, 1g, 250g, 100g, 10g, 50g, 500g.
3,5-ditert-butylbenzoic acid (CAS 16225-26-6) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 3,5-ditert-butylbenzoic acid. InChIKey: NCTSLPBQVXUAHR-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 3,5-ditert-butylbenzoic acid |
| InChIKey | NCTSLPBQVXUAHR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)