Products 1623012-10-1
CAS 1623012-10-1 is the registry number for Tanshinol borneol ester. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate (CAS 1623012-10-1) is a chemical compound with the molecular formula C19H26O5 and a molecular weight of 334.4 g/mol. IUPAC name: [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate. InChIKey: HWZXIGKCWRUJPF-RXMXQMHTSA-N.
| Molecular formula | C19H26O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate |
| InChIKey | HWZXIGKCWRUJPF-RXMXQMHTSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)C[C@@H]2OC(=O)[C@@H](CC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Tanshinol borneol ester, orb1983140