CAS 869109-30-8 appears in our catalog under these names: 3-(Phenylmethoxy)-1,1-cyclobutanedicarboxylic acid diisopropyl diester, 95%, Diisopropyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate, 97%, 97%, 3-(PHENYLMETHOXY)-1,1-CYCLOBUTANEDICARBOXYLIC ACID DIISOPROPYL DIESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 1g, 5g, 100mg, 250mg, 500mg.
Dipropan-2-yl 3-phenylmethoxycyclobutane-1,1-dicarboxylate (CAS 869109-30-8) is a chemical compound with the molecular formula C19H26O5 and a molecular weight of 334.4 g/mol. IUPAC name: dipropan-2-yl 3-phenylmethoxycyclobutane-1,1-dicarboxylate. InChIKey: KEJBIVMGKDBTBK-UHFFFAOYSA-N.
| Molecular formula | C19H26O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | dipropan-2-yl 3-phenylmethoxycyclobutane-1,1-dicarboxylate |
| InChIKey | KEJBIVMGKDBTBK-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)OCC2=CC=CC=C2)C(=O)OC(C)C |
Computed by PubChem (NCBI)