CAS 1623079-32-2 appears in our catalog under these names: 5-(4-Fluorophenyl)-2-(1h-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid, 95%, 5-(4-Fluorophenyl)-2-(1H-pyrrol-1-yl)thiazole-4-carboxylic acid, 97%, 5-(4-Fluorophenyl)-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
5-(4-fluorophenyl)-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1623079-32-2) is a chemical compound with the molecular formula C14H9FN2O2S and a molecular weight of 288.30 g/mol. IUPAC name: 5-(4-fluorophenyl)-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: CDMMDLXUHNYYFW-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O2S |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | CDMMDLXUHNYYFW-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=NC(=C(S2)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)