CAS 618382-80-2 appears in our catalog under these names: 2-(4-Fluoro-phenyl)-5-thiophen-2-yl-2h-pyrazole-3-carboxylic acid, 95%, 1-(4-Fluorophenyl)-3-(thiophen-2-yl)-1H-pyrazole-5-carboxylic acid, 97%, 1-(4-Fluorophenyl)-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(4-fluorophenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid (CAS 618382-80-2) is a chemical compound with the molecular formula C14H9FN2O2S and a molecular weight of 288.30 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid. InChIKey: MSFMKNFGWZDNOE-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O2S |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid |
| InChIKey | MSFMKNFGWZDNOE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN(C(=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)