Products 1623481-80-0
CAS 1623481-80-0 appears in our catalog under these names: ML381(VU0488130), ML381, ML381, 99.87%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 10 mg.
5-[(3-acetylphenoxy)methyl]-N-methyl-N-[(1S)-1-pyridin-2-ylethyl]-1,2-oxazole-3-carboxamide (CAS 1623481-80-0) is a chemical compound with the molecular formula C21H21N3O4 and a molecular weight of 379.4 g/mol. IUPAC name: 5-[(3-acetylphenoxy)methyl]-N-methyl-N-[(1S)-1-pyridin-2-ylethyl]-1,2-oxazole-3-carboxamide. InChIKey: JMYDHMCYZKRDPD-AWEZNQCLSA-N.
| Molecular formula | C21H21N3O4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 5-[(3-acetylphenoxy)methyl]-N-methyl-N-[(1S)-1-pyridin-2-ylethyl]-1,2-oxazole-3-carboxamide |
| InChIKey | JMYDHMCYZKRDPD-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=CC=N1)N(C)C(=O)C2=NOC(=C2)COC3=CC=CC(=C3)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
orb1699925, Ml381(Vu0488130)