CAS 201852-70-2 appears in our catalog under these names: H-Gly-phe-amc, 95%, Gly-Phe-AMC, 97%, H–Gly–Phe–AMC, H-Gly-Phe-AMC, Gly-Phe-AMC, 98.75%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 10mg, 25mg, 10 mg, 1 mg, 5 mg.
(2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide (CAS 201852-70-2) is a chemical compound with the molecular formula C21H21N3O4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide. InChIKey: OXYDLMUFQZNZMD-KRWDZBQOSA-N.
| Molecular formula | C21H21N3O4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide |
| InChIKey | OXYDLMUFQZNZMD-KRWDZBQOSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)CN |
Computed by PubChem (NCBI)