CAS 162426-86-0 is the registry number for (3S,3AR,6R,6aR)-6-methoxyhexahydrofuro[3,2-b]furan-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,3aR,6R,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (CAS 162426-86-0) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: (3S,3aR,6R,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol. InChIKey: DIGYDJCOICLEJE-BDVNFPICSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (3S,3aR,6R,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| InChIKey | DIGYDJCOICLEJE-BDVNFPICSA-N |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
Computed by PubChem (NCBI)