Products 6941-54-4
CAS 6941-54-4 appears in our catalog under these names: (3R,3aR,6S,6aR)-6-Methoxyhexahydrofuro[3,2-b]furan-3-ol, 95%, 2-Monomethyl Isosorbide, 1,4:3,6-Dianhydro- 2- O- methyl-D- glucitol, (3R,3aR,6S,6aR)-6-Methoxyhexahydrofuro[3,2-b]furan-3-ol 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: on request, 50mg, 1g, 10mg, 25mg, 100mg, 250mg.
(3R,3aR,6S,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (CAS 6941-54-4) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: (3R,3aR,6S,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol. InChIKey: DIGYDJCOICLEJE-XZBKPIIZSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (3R,3aR,6S,6aR)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| InChIKey | DIGYDJCOICLEJE-XZBKPIIZSA-N |
| SMILES | CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
Computed by PubChem (NCBI)