Products 1624261-05-7
CAS 1624261-05-7 is the registry number for 6-Bromopyridin-3-yl diisopropylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(6-bromo-3-pyridinyl) N,N-di(propan-2-yl)carbamate (CAS 1624261-05-7) is a chemical compound with the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. IUPAC name: (6-bromo-3-pyridinyl) N,N-di(propan-2-yl)carbamate. InChIKey: RGBDMAMCKNTCSR-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | (6-bromo-3-pyridinyl) N,N-di(propan-2-yl)carbamate |
| InChIKey | RGBDMAMCKNTCSR-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)OC1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)