CAS 1823313-36-5 is the registry number for tert-Butyl 6-bromo-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromo-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (CAS 1823313-36-5) is a chemical compound with the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. IUPAC name: tert-butyl 6-bromo-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate. InChIKey: RAPKZOAPIFUFDQ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | tert-butyl 6-bromo-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| InChIKey | RAPKZOAPIFUFDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=CC=C2Br)C1 |
Computed by PubChem (NCBI)