Products 1624261-08-0
CAS 1624261-08-0 is the registry number for tert-Butyl 5-bromo-6-nitroisoindoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 5-bromo-6-nitro-1,3-dihydroisoindole-2-carboxylate (CAS 1624261-08-0) is a chemical compound with the molecular formula C13H15BrN2O4 and a molecular weight of 343.17 g/mol. IUPAC name: tert-butyl 5-bromo-6-nitro-1,3-dihydroisoindole-2-carboxylate. InChIKey: XWPGGVJFQIZPPI-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O4 |
|---|---|
| Molecular weight | 343.17 g/mol |
| IUPAC name | tert-butyl 5-bromo-6-nitro-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | XWPGGVJFQIZPPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=C(C=C2C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)