CAS 2923227-03-4 is the registry number for tert-Butyl (8-bromo-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(8-bromo-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate (CAS 2923227-03-4) is a chemical compound with the molecular formula C13H15BrN2O4 and a molecular weight of 343.17 g/mol. IUPAC name: tert-butyl N-(8-bromo-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate. InChIKey: UYZUBIXWDDWVRP-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O4 |
|---|---|
| Molecular weight | 343.17 g/mol |
| IUPAC name | tert-butyl N-(8-bromo-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate |
| InChIKey | UYZUBIXWDDWVRP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C(=C1)Br)OCC(=O)N2 |
Computed by PubChem (NCBI)