CAS 1624261-41-1 is the registry number for 2,2,2-Trifluoroacetic acid compound with 3-(2-(methylamino)ethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[2-(methylamino)ethyl]benzoic acid;2,2,2-trifluoroacetic acid (CAS 1624261-41-1) is a chemical compound with the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. IUPAC name: 3-[2-(methylamino)ethyl]benzoic acid;2,2,2-trifluoroacetic acid. InChIKey: SEBWWVHWQXEXJA-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO4 |
|---|---|
| Molecular weight | 293.24 g/mol |
| IUPAC name | 3-[2-(methylamino)ethyl]benzoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | SEBWWVHWQXEXJA-UHFFFAOYSA-N |
| SMILES | CNCCC1=CC(=CC=C1)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)