CAS 2710654-39-8 is the registry number for 3-(3-Trifluoromethyl-phenyl)-propylamine Oxalate. Offered by: TRC. Available pack sizes: 250mg.
Oxalic acid;3-[3-(trifluoromethyl)phenyl]propan-1-amine (CAS 2710654-39-8) is a chemical compound with the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. IUPAC name: oxalic acid;3-[3-(trifluoromethyl)phenyl]propan-1-amine. InChIKey: ILWYOSZHPKMLLP-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO4 |
|---|---|
| Molecular weight | 293.24 g/mol |
| IUPAC name | oxalic acid;3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| InChIKey | ILWYOSZHPKMLLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)