Products 1624262-64-1
CAS 1624262-64-1 is the registry number for Di-tert-butyl 1-(4-chlorobenzyl)hydrazine-1,2-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 1624262-64-1) is a chemical compound with the molecular formula C17H25ClN2O4 and a molecular weight of 356.8 g/mol. IUPAC name: tert-butyl N-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: VZAONRWMMJUJNS-UHFFFAOYSA-N.
| Molecular formula | C17H25ClN2O4 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | tert-butyl N-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | VZAONRWMMJUJNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(CC1=CC=C(C=C1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)