CAS 2140267-06-5 is the registry number for 2-Benzyl 1-tert-butyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-O-benzyl 1-O-tert-butyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 2140267-06-5) is a chemical compound with the molecular formula C17H25ClN2O4 and a molecular weight of 356.8 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: JNNDXZZOSCQKBR-LMRHVHIWSA-N.
| Molecular formula | C17H25ClN2O4 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | JNNDXZZOSCQKBR-LMRHVHIWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)