Products 1624294-56-9
CAS 1624294-56-9 is the registry number for 1-(9,9-Diethyl-9H-fluoren-2-yl)-1,2-propanedione 2-oxime, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(2E)-1-(9,9-diethylfluoren-2-yl)-2-hydroxyiminopropan-1-one (CAS 1624294-56-9) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: (2E)-1-(9,9-diethylfluoren-2-yl)-2-hydroxyiminopropan-1-one. InChIKey: LMSHCNROCFSQCX-FYJGNVAPSA-N.
| Molecular formula | C20H21NO2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (2E)-1-(9,9-diethylfluoren-2-yl)-2-hydroxyiminopropan-1-one |
| InChIKey | LMSHCNROCFSQCX-FYJGNVAPSA-N |
| SMILES | CCC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)/C(=N/O)/C)CC |
Computed by PubChem (NCBI)