CAS 1625-91-8 appears in our catalog under these names: 4,4'–Di–tert–butylbiphenyl, 4,4'-Di-tert-butylbiphenyl, >98.0%(GC), 4,4'-Di-tert-butylbiphenyl, 99+%, 4,4'-Di-tert-butyl-1,1'-biphenyl 97%, 4,4'-DI-TERT-BUTYLBIPHENYL, 99%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 5g, 25g, 1000g, 10g, 250g, 1g.
1-tert-butyl-4-(4-tert-butylphenyl)benzene (CAS 1625-91-8) is a chemical compound with the molecular formula C20H26 and a molecular weight of 266.4 g/mol. IUPAC name: 1-tert-butyl-4-(4-tert-butylphenyl)benzene. InChIKey: CDKCEZNPAYWORX-UHFFFAOYSA-N.
| Molecular formula | C20H26 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 1-tert-butyl-4-(4-tert-butylphenyl)benzene |
| InChIKey | CDKCEZNPAYWORX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)