CAS 3074-89-3 is the registry number for 1,1'-Biphenyl,2,2',3,3',5,5',6,6'-octamethyl-. Offered by: Chemat. Available pack sizes: 100mg.
1,2,4,5-tetramethyl-3-(2,3,5,6-tetramethylphenyl)benzene (CAS 3074-89-3) is a chemical compound with the molecular formula C20H26 and a molecular weight of 266.4 g/mol. IUPAC name: 1,2,4,5-tetramethyl-3-(2,3,5,6-tetramethylphenyl)benzene. InChIKey: UYPFXMMSUVAGMM-UHFFFAOYSA-N.
| Molecular formula | C20H26 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 1,2,4,5-tetramethyl-3-(2,3,5,6-tetramethylphenyl)benzene |
| InChIKey | UYPFXMMSUVAGMM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)C2=C(C(=CC(=C2C)C)C)C)C)C |
Computed by PubChem (NCBI)