CAS 16252-88-3 appears in our catalog under these names: 5-Nitro-2,1,3-benzothiadiazole, 95%, 5–Nitrobenzo(c)(1,2,5)thiadiazole, 5-Nitrobenzo[c][1,2,5]thiadiazole 95+%, 5-Nitro-2,1,3-benzothiadiazole, 95%, 95%, 5-Nitrobenzo[c][1,2,5]thiadiazole, 95+%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg, 500mg.
5-nitro-2,1,3-benzothiadiazole (CAS 16252-88-3) is a chemical compound with the molecular formula C6H3N3O2S and a molecular weight of 181.17 g/mol. IUPAC name: 5-nitro-2,1,3-benzothiadiazole. InChIKey: BXZPSERJJMAPSV-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O2S |
|---|---|
| Molecular weight | 181.17 g/mol |
| IUPAC name | 5-nitro-2,1,3-benzothiadiazole |
| InChIKey | BXZPSERJJMAPSV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)