CAS 948306-26-1 is the registry number for 6-Nitrothiazolo[5,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-nitro-[1,3]thiazolo[5,4-b]pyridine (CAS 948306-26-1) is a chemical compound with the molecular formula C6H3N3O2S and a molecular weight of 181.17 g/mol. IUPAC name: 6-nitro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: HAVAZNINDKYVRW-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O2S |
|---|---|
| Molecular weight | 181.17 g/mol |
| IUPAC name | 6-nitro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | HAVAZNINDKYVRW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CS2)[N+](=O)[O-] |
Computed by PubChem (NCBI)