Products 162648-31-9
CAS 162648-31-9 appears in our catalog under these names: 1-Benzoyl-4-methylpiperidine-4-carboxylic acid, 1-Benzoyl-4-methylpiperidine-4-carboxylic acid, 98%, 98%, 1-benzoyl-4-methylpiperidine-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 25mg, 100mg.
1-benzoyl-4-methylpiperidine-4-carboxylic acid (CAS 162648-31-9) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 1-benzoyl-4-methylpiperidine-4-carboxylic acid. InChIKey: JKGLTCBDQLNFEM-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-benzoyl-4-methylpiperidine-4-carboxylic acid |
| InChIKey | JKGLTCBDQLNFEM-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)