CAS 162650-62-6 appears in our catalog under these names: 2-(Dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(Dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid, 2-Dimethylamino-4-methyl-thiazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg, 500mg, 2.5g.
2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 162650-62-6) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: AWFVJEVQVOMTOD-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | AWFVJEVQVOMTOD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N(C)C)C(=O)O |
Computed by PubChem (NCBI)